Talastine |
|
| ATC code | |
|---|
|
4-benzyl-2-[2-(dimethylamino)ethyl]phthalazin-1(2H)-one
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C19H21N3O |
|---|
| Molar mass | 307.397 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C1c3ccccc3\C(=N/N1CCN(C)C)Cc2ccccc2
|
InChI=1S/C19H21N3O/c1-21(2)12-13-22-19(23)17-11-7-6-10-16(17)18(20-22)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3 YKey:LCAAMXMULMCKLJ-UHFFFAOYSA-N Y
|
| (verify) |
Talastine (trade name Ahanon) is an antihistamine.[1]
Synthesis
The amide proton from 4-Benzylphalazone is abstracted with KOH, which is then alkylated with dimethylaminoethyl chloride.[2][3]
References
- ^ Richter G, Kühn E (1990). "[Talastine (Ahanon) as a cause of allergic drug exanthema]". Dermatologische Monatschrift (in German). 176 (2–3): 111–3. PMID 1973126.
- ^ DE 1046625, Engelbrecht, et al., issued 1958, assigned to VEB Deutsches Hydrierwerk Rodleben
- ^ US 3017411, Engelbrecht, et al., issued 1962, assigned to VEB Deutsches Hydrierwerk Rodleben
External links
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | | Agonists |
- 4-Methylhistamine
- α-Methylhistamine
- Histamine
- L-Histidine
- OUP-16
- VUF-8430
|
|---|
| Antagonists | |
|---|
|
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|