Impromidine |
 |
|
| ATC code | |
|---|
|
2-[3-(1H-imidazol-5-yl)propyl]-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| IUPHAR/BPS | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C14H23N7S |
|---|
| Molar mass | 321.45 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
Cc1[nH]cnc1CSCCNC(=N)NCCCc2c[nH]cn2
|
InChI=1S/C14H23N7S/c1-11-13(21-10-19-11)8-22-6-5-18-14(15)17-4-2-3-12-7-16-9-20-12/h7,9-10H,2-6,8H2,1H3,(H,16,20)(H,19,21)(H3,15,17,18) NKey:MURRAGMMNAYLNA-UHFFFAOYSA-N N
|
N Y (what is this?) (verify) |
Impromidine (INN) is a highly potent and specific histamine H2 receptor agonist.[1]
It has been used diagnostically as a gastric secretion indicator.
See also
References
- ^ Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A (1978). "Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors". Nature. 276 (5686): 403–5. doi:10.1038/276403a0. PMID 714166. S2CID 4242863.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | | Agonists |
- 4-Methylhistamine
- α-Methylhistamine
- Histamine
- L-Histidine
- OUP-16
- VUF-8430
|
|---|
| Antagonists | |
|---|
|
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|