SCH-79687
|
| Names
|
Preferred IUPAC name
N-(3,5-Dichlorophenyl)-N′-({4-[(1H-imidazol-4-yl)methyl]phenyl}methyl)urea
|
| Identifiers
|
CAS Number
|
|
3D model (JSmol)
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C18H16Cl2N4O/c19-14-6-15(20)8-16(7-14)24-18(25)22-9-13-3-1-12(2-4-13)5-17-10-21-11-23-17/h1-4,6-8,10-11H,5,9H2,(H,21,23)(H2,22,24,25) YKey: CXNCQFJNXQAFND-UHFFFAOYSA-N YInChI=1/C18H16Cl2N4O/c19-14-6-15(20)8-16(7-14)24-18(25)22-9-13-3-1-12(2-4-13)5-17-10-21-11-23-17/h1-4,6-8,10-11H,5,9H2,(H,21,23)(H2,22,24,25) Key: CXNCQFJNXQAFND-UHFFFAOYAC
|
Clc1cc(cc(Cl)c1)NC(=O)NCc2ccc(cc2)Cc3c[nH]cn3
|
| Properties
|
Chemical formula
|
C18H16Cl2N4O
|
| Molar mass
|
375.251 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
SCH-79687 is a histamine antagonist selective for the H3 subtype.[1]
References
- ^ McLeod RL, Rizzo CA, West RE Jr, Aslanian R, McCormick K, Bryant M, Hsieh Y, Korfmacher W, Mingo GG, Varty L, Williams SM, Shih NY, Egan RW, Hey JA. Pharmacological characterization of the novel histamine H3-receptor antagonist N-(3,5-dichlorophenyl)-N'-[[4-(1H-imidazol-4-ylmethyl)phenyl]-methyl]-urea (SCH 79687). Journal of Pharmacology and Experimental Therapeutics. 2003 Jun;305(3):1037-44. PMID 12649305 doi=10.1124/jpet.103.049254
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | | Agonists |
- 4-Methylhistamine
- α-Methylhistamine
- Histamine
- L-Histidine
- OUP-16
- VUF-8430
|
|---|
| Antagonists | |
|---|
|
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|