Atibeprone |
|
| ATC code | |
|---|
|
3,4-dimethyl-7-{[5-(propan-2-yl)-1,3,4-thiadiazol-2-yl]methoxy}-2H-chromen-2-one
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C17H18N2O3S |
|---|
| Molar mass | 330.40 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C/2Oc3cc(OCc1nnc(s1)C(C)C)ccc3\C(=C\2C)C
|
InChI=1S/C17H18N2O3S/c1-9(2)16-19-18-15(23-16)8-21-12-5-6-13-10(3)11(4)17(20)22-14(13)7-12/h5-7,9H,8H2,1-4H3 YKey:HQTNJPCZUQAYAB-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
Atibeprone is an antidepressant which was developed in the mid-1990s, but was never marketed.[1]
References
|
|---|
|
|---|
| SSRIsTooltip Selective serotonin reuptake inhibitors | |
|---|
| SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
|---|
| NRIsTooltip Norepinephrine reuptake inhibitors | |
|---|
| NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
|---|
| NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
|---|
| SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
|---|
| SMSTooltip Serotonin modulator and stimulators | |
|---|
| Others | |
|---|
|
|
|
|---|
| TCAsTooltip Tricyclic antidepressants | |
|---|
| TeCAsTooltip Tetracyclic antidepressants | |
|---|
| Others | |
|---|
|
|
|
|---|
| Non-selective | |
|---|
| MAOATooltip Monoamine oxidase A-selective | |
|---|
| MAOBTooltip Monoamine oxidase B-selective | |
|---|
|
|
|
|
|