Aluminium clofibrate |
|
| MedlinePlus | a699047 |
|---|
| ATC code | |
|---|
|
| Metabolism | Hydrolyzed to clofibric acid and aluminium hydroxide |
|---|
| Excretion | Renal |
|---|
|
Aluminium bis(2-(4-chlorophenoxy)-2-methylpropanoate) hydroxide
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.042.237 |
|---|
|
| Formula | C20H24Cl2O7 |
|---|
| Molar mass | 447.31 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
Clc2ccc(OC(C)(C)C(=O)O[Al](O)OC(=O)C(C)(C)Oc1ccc(Cl)cc1)cc2
|
InChI=1S/2C10H11ClO3.Al.H2O/c2*1-10(2,9(12)13)14-8-5-3-7(11)4-6-8;;/h2*3-6H,1-2H3,(H,12,13);;1H2/q;;+3;/p-3 YKey:USWVMPGQVYZHCA-UHFFFAOYSA-K Y
|
N Y (what is this?) (verify) |
Aluminium clofibrate (or alfibrate) is a fibrate.
See also
References
|
|---|
| PPARαTooltip Peroxisome proliferator-activated receptor alpha |
- Antagonists: GW-6471
- MK-886
|
|---|
| PPARδTooltip Peroxisome proliferator-activated receptor delta |
- Antagonists: FH-535
- GSK-0660
- GSK-3787
|
|---|
| PPARγTooltip Peroxisome proliferator-activated receptor gamma |
- SPPARMsTooltip Selective PPARγ modulator: BADGE
- EPI-001
- INT-131
- MK-0533
- S26948
- Antagonists: FH-535
- GW-9662
- SR-202
- T-0070907
|
|---|
| Non-selective | |
|---|
- See also
- Receptor/signaling modulators
|