Morclofone |
|
| AHFS/Drugs.com | International Drug Names |
|---|
| ATC code | |
|---|
|
(4-chlorophenyl)-[3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methanone
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.046.202 |
|---|
|
| Formula | C21H24ClNO5 |
|---|
| Molar mass | 405.88 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
Clc1ccc(cc1)C(=O)c3cc(OC)c(OCCN2CCOCC2)c(OC)c3
|
InChI=1S/C21H24ClNO5/c1-25-18-13-16(20(24)15-3-5-17(22)6-4-15)14-19(26-2)21(18)28-12-9-23-7-10-27-11-8-23/h3-6,13-14H,7-12H2,1-2H3 YKey:KVCJCEKJKGLBOK-UHFFFAOYSA-N Y
|
| (verify) |
Morclofone is a cough suppressant.[1]
References
- ^ Schenker H (April 1983). "[Efficacy of morclofon, a new synthetic antitussive agent, in geriatric patients. Results of a double-blind study]". Therapeutische Umschau. Revue Therapeutique. 40 (4): 358–61. PMID 6346561.