Metizoline |
|
| Trade names | Ellsyl |
|---|
Routes of administration | Nasal |
|---|
| ATC code | |
|---|
|
2-[(2-methyl-1-benzothien-3-yl)methyl]-4,5-dihydro-1H-imidazole
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C13H14N2S |
|---|
| Molar mass | 230.33 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CC1=C(C2=CC=CC=C2S1)CC3=NCCN3
|
InChI=1S/C13H14N2S/c1-9-11(8-13-14-6-7-15-13)10-4-2-3-5-12(10)16-9/h2-5H,6-8H2,1H3,(H,14,15) NKey:NDNKHWUXXOFHTD-UHFFFAOYSA-N N
|
N Y (what is this?) (verify) |
Metizoline (trade name Ellsyl) is a nasal decongestant against allergic and vasomotor rhinitis.[1]
References
- ^ Zumpft CW (January 1975). "Double-blind comparison of metizoline hydrochloride (Ellsyl) and phenylephrine in allergic and vasomotor rhinitis". Current Therapeutic Research, Clinical and Experimental. 17 (1): 40–6. PMID 49255.