Clefamide |
|
| Trade names | Mebinol |
|---|
| ATC code | |
|---|
|
2,2-Dichloro-N-(2-hydroxyethyl)-N-[[4-(4-nitrophenoxy)phenyl]methyl]
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.020.631 |
|---|
|
| Formula | C17H16Cl2N2O5 |
|---|
| Molar mass | 399.22 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
ClC(Cl)C(=O)N(CCO)Cc2ccc(Oc1ccc(cc1)[N+]([O-])=O)cc2
|
InChI=1S/C17H16Cl2N2O5/c18-16(19)17(23)20(9-10-22)11-12-1-5-14(6-2-12)26-15-7-3-13(4-8-15)21(24)25/h1-8,16,22H,9-11H2 YKey:ODCUSWJXZDHLKV-UHFFFAOYSA-N Y
|
| (verify) |
Clefamide (trade name Mebinol) is an antiprotozoal agent that was used to treat amoebiasis in the 1960s.[1] There is no evidence for any later use of the drug.
References
- ^ Rodrigues LD, Jafferian PA, Vilella M, Costa AA, de Mello EB (November 1968). "[Comparative study on 3 amebicides: teclozine, clefamide and a combination of clefamide and iodo-chloro-oxyquinolines and streptomycin]". Hospital. 74 (5): 1563–73. PMID 5305335.